C16H27FO4 — CID 87227764
4-O-(2,2-dimethylheptan-3-yl) 1-O-(3-fluoropropyl) (E)-but-2-enedioate (PubChem CID 87227764) has the molecular formula C16H27FO4 and a molecular weight of 302.39 g/mol. Its IUPAC name is 4-O-(2,2-dimethylheptan-3-yl) 1-O-(3-fluoropropyl) (E)-but-2-enedioate.
| Compound Name | 4-O-(2,2-dimethylheptan-3-yl) 1-O-(3-fluoropropyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 87227764 |
| Molecular Formula | C16H27FO4 |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 4-O-(2,2-dimethylheptan-3-yl) 1-O-(3-fluoropropyl) (E)-but-2-enedioate |
| SMILES | CCCCC(OC(=O)/C=C/C(=O)OCCCF)C(C)(C)C |
| InChI | InChI=1S/C16H27FO4/c1-5-6-8-13(16(2,3)4)21-15(19)10-9-14(18)20-12-7-11-17/h9-10,13H,5-8,11-12H2,1-4H3/b10-9+ |
| InChIKey | VLFUJIWTTQOESK-MDZDMXLPSA-N |
| XLogP | 3.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|