C8H15NO12S2 — CID 87227868
[(2R,3R,4R,5R)-2-acetamido-4,5-dihydroxy-1-oxo-6-sulfooxyhexan-3-yl] hydrogen sulfate (PubChem CID 87227868) has the molecular formula C8H15NO12S2 and a molecular weight of 381.34 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-acetamido-4,5-dihydroxy-1-oxo-6-sulfooxyhexan-3-yl] hydrogen sulfate.
| Compound Name | [(2R,3R,4R,5R)-2-acetamido-4,5-dihydroxy-1-oxo-6-sulfooxyhexan-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 87227868 |
| Molecular Formula | C8H15NO12S2 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | [(2R,3R,4R,5R)-2-acetamido-4,5-dihydroxy-1-oxo-6-sulfooxyhexan-3-yl] hydrogen sulfate |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](OS(=O)(=O)O)[C@H](O)[C@H](O)COS(=O)(=O)O |
| InChI | InChI=1S/C8H15NO12S2/c1-4(11)9-5(2-10)8(21-23(17,18)19)7(13)6(12)3-20-22(14,15)16/h2,5-8,12-13H,3H2,1H3,(H,9,11)(H,14,15,16)(H,17,18,19)/t5-,6+,7+,8+/m0/s1 |
| InChIKey | UGMQKKPJQYOFII-LXGUWJNJSA-N |
| XLogP | -3.58 |
| TPSA | 213.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|