C23H21F3N6O2S — CID 87227945
N-[6-ethoxy-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]benzamide (PubChem CID 87227945) has the molecular formula C23H21F3N6O2S and a molecular weight of 502.52 g/mol. Its IUPAC name is N-[6-ethoxy-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]benzamide.
| Compound Name | N-[6-ethoxy-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]benzamide |
|---|---|
| PubChem CID | 87227945 |
| Molecular Formula | C23H21F3N6O2S |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | N-[6-ethoxy-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]benzamide |
| SMILES | CCOc1nc(N2CCNCC2)nc2c1sc1nc(NC(=O)c3ccccc3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C23H21F3N6O2S/c1-2-34-20-18-17(30-22(31-20)32-10-8-27-9-11-32)16-14(23(24,25)26)12-15(29-21(16)35-18)28-19(33)13-6-4-3-5-7-13/h3-7,12,27H,2,8-11H2,1H3,(H,28,29,33) |
| InChIKey | QVRLFKYZKALXSU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |