About 2-ethoxy-6-methyl-3,1-benzoxazin-4-one;N-methylformamide
2-ethoxy-6-methyl-3,1-benzoxazin-4-one;N-methylformamide (PubChem CID 87228115) has the molecular formula C13H16N2O4
and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-ethoxy-6-methyl-3,1-benzoxazin-4-one;N-methylformamide.
Molecular Properties
| Compound Name | 2-ethoxy-6-methyl-3,1-benzoxazin-4-one;N-methylformamide |
| PubChem CID | 87228115 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-ethoxy-6-methyl-3,1-benzoxazin-4-one;N-methylformamide |
| SMILES | CCOc1nc2ccc(C)cc2c(=O)o1.CNC=O |
| InChI | InChI=1S/C11H11NO3.C2H5NO/c1-3-14-11-12-9-5-4-7(2)6-8(9)10(13)15-11;1-3-2-4/h4-6H,3H2,1-2H3;2H,1H3,(H,3,4) |
| InChIKey | CBONETRMVGNKTH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-6-methyl-3,1-benzoxazin-4-one;N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-6-methyl-3,1-benzoxazin-4-one;N-methylformamide?
The IUPAC name of 2-ethoxy-6-methyl-3,1-benzoxazin-4-one;N-methylformamide (CID 87228115) is 2-ethoxy-6-methyl-3,1-benzoxazin-4-one;N-methylformamide.
What is the SMILES notation for 2-ethoxy-6-methyl-3,1-benzoxazin-4-one;N-methylformamide?
The canonical SMILES for 2-ethoxy-6-methyl-3,1-benzoxazin-4-one;N-methylformamide is CCOc1nc2ccc(C)cc2c(=O)o1.CNC=O.
What is the InChIKey of 2-ethoxy-6-methyl-3,1-benzoxazin-4-one;N-methylformamide?
The InChIKey is CBONETRMVGNKTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3.C2H5NO/c1-3-14-11-12-9-5-4-7(2)6-8(9)10(13)15-11;1-3-2-4/h4-6H,3H2,1-2H3;2H,1H3,(H,3,4).
What are the key properties of 2-ethoxy-6-methyl-3,1-benzoxazin-4-one;N-methylformamide?
2-ethoxy-6-methyl-3,1-benzoxazin-4-one;N-methylformamide has a molecular weight of 264.28 g/mol, XLogP of 1.26, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-6-methyl-3,1-benzoxazin-4-one;N-methylformamide is sourced from PubChem (CID 87228115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).