About 1-ethenyl-9H-carbazole;2,4,7-trinitrofluoren-1-one
1-ethenyl-9H-carbazole;2,4,7-trinitrofluoren-1-one (PubChem CID 87228474) has the molecular formula C27H16N4O7
and a molecular weight of 508.45 g/mol. Its IUPAC name is 1-ethenyl-9H-carbazole;2,4,7-trinitrofluoren-1-one.
Molecular Properties
| Compound Name | 1-ethenyl-9H-carbazole;2,4,7-trinitrofluoren-1-one |
| PubChem CID | 87228474 |
| Molecular Formula | C27H16N4O7 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 1-ethenyl-9H-carbazole;2,4,7-trinitrofluoren-1-one |
| SMILES | C=Cc1cccc2c1[nH]c1ccccc12.O=C1C2=Cc3cc([N+](=O)[O-])ccc3C2=C([N+](=O)[O-])C=C1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11N.C13H5N3O7/c1-2-10-6-5-8-12-11-7-3-4-9-13(11)15-14(10)12;17-13-9-4-6-3-7(14(18)19)1-2-8(6)12(9)10(15(20)21)5-11(13)16(22)23/h2-9,15H,1H2;1-5H |
| InChIKey | CDLYVQNCBIMCHN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 162.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-9H-carbazole;2,4,7-trinitrofluoren-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-9H-carbazole;2,4,7-trinitrofluoren-1-one?
The IUPAC name of 1-ethenyl-9H-carbazole;2,4,7-trinitrofluoren-1-one (CID 87228474) is 1-ethenyl-9H-carbazole;2,4,7-trinitrofluoren-1-one.
What is the SMILES notation for 1-ethenyl-9H-carbazole;2,4,7-trinitrofluoren-1-one?
The canonical SMILES for 1-ethenyl-9H-carbazole;2,4,7-trinitrofluoren-1-one is C=Cc1cccc2c1[nH]c1ccccc12.O=C1C2=Cc3cc([N+](=O)[O-])ccc3C2=C([N+](=O)[O-])C=C1[N+](=O)[O-].
What is the InChIKey of 1-ethenyl-9H-carbazole;2,4,7-trinitrofluoren-1-one?
The InChIKey is CDLYVQNCBIMCHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N.C13H5N3O7/c1-2-10-6-5-8-12-11-7-3-4-9-13(11)15-14(10)12;17-13-9-4-6-3-7(14(18)19)1-2-8(6)12(9)10(15(20)21)5-11(13)16(22)23/h2-9,15H,1H2;1-5H.
What are the key properties of 1-ethenyl-9H-carbazole;2,4,7-trinitrofluoren-1-one?
1-ethenyl-9H-carbazole;2,4,7-trinitrofluoren-1-one has a molecular weight of 508.45 g/mol, XLogP of 5.69, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-9H-carbazole;2,4,7-trinitrofluoren-1-one is sourced from PubChem (CID 87228474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).