C47H59Cl2N2P — CID 87228612
[2-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-1,3-dichlorocyclohexyl]-dicyclohexyl-(2-phenylethenylidene)-λ5-phosphane (PubChem CID 87228612) has the molecular formula C47H59Cl2N2P and a molecular weight of 753.88 g/mol. Its IUPAC name is [2-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-1,3-dichlorocyclohexyl]-dicyclohexyl-(2-phenylethenylidene)-λ5-phosphane.
| Compound Name | [2-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-1,3-dichlorocyclohexyl]-dicyclohexyl-(2-phenylethenylidene)-λ5-phosphane |
|---|---|
| PubChem CID | 87228612 |
| Molecular Formula | C47H59Cl2N2P |
| Molecular Weight | 753.88 g/mol |
| Exact Mass | 752.38 |
| IUPAC Name | [2-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-1,3-dichlorocyclohexyl]-dicyclohexyl-(2-phenylethenylidene)-λ5-phosphane |
| SMILES | Cc1cc(C)c(N2C=CN(c3c(C)cc(C)cc3C)C2=C2C(Cl)CCCC2(Cl)P(=C=Cc2ccccc2)(C2CCCCC2)C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C47H59Cl2N2P/c1-33-29-35(3)44(36(4)30-33)50-26-27-51(45-37(5)31-34(2)32-38(45)6)46(50)43-42(48)23-16-25-47(43,49)52(40-19-12-8-13-20-40,41-21-14-9-15-22-41)28-24-39-17-10-7-11-18-39/h7,10-11,17-18,24,26-27,29-32,40-42H,8-9,12-16,19-23,25H2,1-6H3 |
| InChIKey | YUXFCCBDSBRBRI-UHFFFAOYSA-N |
| XLogP | 14.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.88 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|