About 1,2-dimethyl-3-octylimidazol-1-ium;trifluoromethanesulfonate
1,2-dimethyl-3-octylimidazol-1-ium;trifluoromethanesulfonate (PubChem CID 87228860) has the molecular formula C14H25F3N2O3S
and a molecular weight of 358.43 g/mol. Its IUPAC name is 1,2-dimethyl-3-octylimidazol-1-ium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1,2-dimethyl-3-octylimidazol-1-ium;trifluoromethanesulfonate |
| PubChem CID | 87228860 |
| Molecular Formula | C14H25F3N2O3S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1,2-dimethyl-3-octylimidazol-1-ium;trifluoromethanesulfonate |
| SMILES | CCCCCCCCn1cc[n+](C)c1C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C13H25N2.CHF3O3S/c1-4-5-6-7-8-9-10-15-12-11-14(3)13(15)2;2-1(3,4)8(5,6)7/h11-12H,4-10H2,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | ULSWXCMOBJEYLS-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-3-octylimidazol-1-ium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-3-octylimidazol-1-ium;trifluoromethanesulfonate?
The IUPAC name of 1,2-dimethyl-3-octylimidazol-1-ium;trifluoromethanesulfonate (CID 87228860) is 1,2-dimethyl-3-octylimidazol-1-ium;trifluoromethanesulfonate.
What is the SMILES notation for 1,2-dimethyl-3-octylimidazol-1-ium;trifluoromethanesulfonate?
The canonical SMILES for 1,2-dimethyl-3-octylimidazol-1-ium;trifluoromethanesulfonate is CCCCCCCCn1cc[n+](C)c1C.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 1,2-dimethyl-3-octylimidazol-1-ium;trifluoromethanesulfonate?
The InChIKey is ULSWXCMOBJEYLS-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H25N2.CHF3O3S/c1-4-5-6-7-8-9-10-15-12-11-14(3)13(15)2;2-1(3,4)8(5,6)7/h11-12H,4-10H2,1-3H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of 1,2-dimethyl-3-octylimidazol-1-ium;trifluoromethanesulfonate?
1,2-dimethyl-3-octylimidazol-1-ium;trifluoromethanesulfonate has a molecular weight of 358.43 g/mol, XLogP of 3.03, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-3-octylimidazol-1-ium;trifluoromethanesulfonate is sourced from PubChem (CID 87228860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).