C22H19FN6O2S2 — CID 87229692
N-[[(1S,2S,5R)-3-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 87229692) has the molecular formula C22H19FN6O2S2 and a molecular weight of 482.57 g/mol. Its IUPAC name is N-[[(1S,2S,5R)-3-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | N-[[(1S,2S,5R)-3-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 87229692 |
| Molecular Formula | C22H19FN6O2S2 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | N-[[(1S,2S,5R)-3-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | Nc1nc(C(=O)N2C[C@@H]3C[C@@H]3[C@H]2CNC(=O)c2cnc3sccn23)c(-c2cccc(F)c2)s1 |
| InChI | InChI=1S/C22H19FN6O2S2/c23-13-3-1-2-11(6-13)18-17(27-21(24)33-18)20(31)29-10-12-7-14(12)15(29)8-25-19(30)16-9-26-22-28(16)4-5-32-22/h1-6,9,12,14-15H,7-8,10H2,(H2,24,27)(H,25,30)/t12-,14-,15+/m0/s1 |
| InChIKey | ZIOWGURXHXKYFM-AEGPPILISA-N |
| XLogP | 3.13 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |