About 1-[2-(cyclopentanecarbonyl)-4-pyridinyl]-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea
1-[2-(cyclopentanecarbonyl)-4-pyridinyl]-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea (PubChem CID 87230281) has the molecular formula C16H18N4O4S2
and a molecular weight of 394.48 g/mol. Its IUPAC name is 1-[2-(cyclopentanecarbonyl)-4-pyridinyl]-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-[2-(cyclopentanecarbonyl)-4-pyridinyl]-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea |
| PubChem CID | 87230281 |
| Molecular Formula | C16H18N4O4S2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1-[2-(cyclopentanecarbonyl)-4-pyridinyl]-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea |
| SMILES | CS(=O)(=O)c1cnc(NC(=O)Nc2ccnc(C(=O)C3CCCC3)c2)s1 |
| InChI | InChI=1S/C16H18N4O4S2/c1-26(23,24)13-9-18-16(25-13)20-15(22)19-11-6-7-17-12(8-11)14(21)10-4-2-3-5-10/h6-10H,2-5H2,1H3,(H2,17,18,19,20,22) |
| InChIKey | GFLQZGXESCNEFI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[2-(cyclopentanecarbonyl)-4-pyridinyl]-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(cyclopentanecarbonyl)-4-pyridinyl]-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea?
The IUPAC name of 1-[2-(cyclopentanecarbonyl)-4-pyridinyl]-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea (CID 87230281) is 1-[2-(cyclopentanecarbonyl)-4-pyridinyl]-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-[2-(cyclopentanecarbonyl)-4-pyridinyl]-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-[2-(cyclopentanecarbonyl)-4-pyridinyl]-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea is CS(=O)(=O)c1cnc(NC(=O)Nc2ccnc(C(=O)C3CCCC3)c2)s1.
What is the InChIKey of 1-[2-(cyclopentanecarbonyl)-4-pyridinyl]-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea?
The InChIKey is GFLQZGXESCNEFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O4S2/c1-26(23,24)13-9-18-16(25-13)20-15(22)19-11-6-7-17-12(8-11)14(21)10-4-2-3-5-10/h6-10H,2-5H2,1H3,(H2,17,18,19,20,22).
What are the key properties of 1-[2-(cyclopentanecarbonyl)-4-pyridinyl]-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea?
1-[2-(cyclopentanecarbonyl)-4-pyridinyl]-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea has a molecular weight of 394.48 g/mol, XLogP of 2.96, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(cyclopentanecarbonyl)-4-pyridinyl]-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 87230281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).