C19H24N6O2S — CID 87230423
1-[2-(cyclopentanecarbonyl)-4-methylphenyl]-3-[5-[(diaminomethylideneamino)methyl]-1,3-thiazol-2-yl]urea (PubChem CID 87230423) has the molecular formula C19H24N6O2S and a molecular weight of 400.51 g/mol. Its IUPAC name is 1-[2-(cyclopentanecarbonyl)-4-methylphenyl]-3-[5-[(diaminomethylideneamino)methyl]-1,3-thiazol-2-yl]urea.
| Compound Name | 1-[2-(cyclopentanecarbonyl)-4-methylphenyl]-3-[5-[(diaminomethylideneamino)methyl]-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 87230423 |
| Molecular Formula | C19H24N6O2S |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1-[2-(cyclopentanecarbonyl)-4-methylphenyl]-3-[5-[(diaminomethylideneamino)methyl]-1,3-thiazol-2-yl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2ncc(CN=C(N)N)s2)c(C(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C19H24N6O2S/c1-11-6-7-15(14(8-11)16(26)12-4-2-3-5-12)24-18(27)25-19-23-10-13(28-19)9-22-17(20)21/h6-8,10,12H,2-5,9H2,1H3,(H4,20,21,22)(H2,23,24,25,27) |
| InChIKey | NJWLDBJNAYHNKO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|