About ethyl 2-[4-[(5-bromo-1,3-thiazol-2-yl)carbamoylamino]-2-(cyclopentanecarbonyl)phenyl]acetate
ethyl 2-[4-[(5-bromo-1,3-thiazol-2-yl)carbamoylamino]-2-(cyclopentanecarbonyl)phenyl]acetate (PubChem CID 87230528) has the molecular formula C20H22BrN3O4S
and a molecular weight of 480.38 g/mol. Its IUPAC name is ethyl 2-[4-[(5-bromo-1,3-thiazol-2-yl)carbamoylamino]-2-(cyclopentanecarbonyl)phenyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[4-[(5-bromo-1,3-thiazol-2-yl)carbamoylamino]-2-(cyclopentanecarbonyl)phenyl]acetate |
| PubChem CID | 87230528 |
| Molecular Formula | C20H22BrN3O4S |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | ethyl 2-[4-[(5-bromo-1,3-thiazol-2-yl)carbamoylamino]-2-(cyclopentanecarbonyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NC(=O)Nc2ncc(Br)s2)cc1C(=O)C1CCCC1 |
| InChI | InChI=1S/C20H22BrN3O4S/c1-2-28-17(25)9-13-7-8-14(10-15(13)18(26)12-5-3-4-6-12)23-19(27)24-20-22-11-16(21)29-20/h7-8,10-12H,2-6,9H2,1H3,(H2,22,23,24,27) |
| InChIKey | SAXCNEGROZCHKC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[4-[(5-bromo-1,3-thiazol-2-yl)carbamoylamino]-2-(cyclopentanecarbonyl)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-[(5-bromo-1,3-thiazol-2-yl)carbamoylamino]-2-(cyclopentanecarbonyl)phenyl]acetate?
The IUPAC name of ethyl 2-[4-[(5-bromo-1,3-thiazol-2-yl)carbamoylamino]-2-(cyclopentanecarbonyl)phenyl]acetate (CID 87230528) is ethyl 2-[4-[(5-bromo-1,3-thiazol-2-yl)carbamoylamino]-2-(cyclopentanecarbonyl)phenyl]acetate.
What is the SMILES notation for ethyl 2-[4-[(5-bromo-1,3-thiazol-2-yl)carbamoylamino]-2-(cyclopentanecarbonyl)phenyl]acetate?
The canonical SMILES for ethyl 2-[4-[(5-bromo-1,3-thiazol-2-yl)carbamoylamino]-2-(cyclopentanecarbonyl)phenyl]acetate is CCOC(=O)Cc1ccc(NC(=O)Nc2ncc(Br)s2)cc1C(=O)C1CCCC1.
What is the InChIKey of ethyl 2-[4-[(5-bromo-1,3-thiazol-2-yl)carbamoylamino]-2-(cyclopentanecarbonyl)phenyl]acetate?
The InChIKey is SAXCNEGROZCHKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22BrN3O4S/c1-2-28-17(25)9-13-7-8-14(10-15(13)18(26)12-5-3-4-6-12)23-19(27)24-20-22-11-16(21)29-20/h7-8,10-12H,2-6,9H2,1H3,(H2,22,23,24,27).
What are the key properties of ethyl 2-[4-[(5-bromo-1,3-thiazol-2-yl)carbamoylamino]-2-(cyclopentanecarbonyl)phenyl]acetate?
ethyl 2-[4-[(5-bromo-1,3-thiazol-2-yl)carbamoylamino]-2-(cyclopentanecarbonyl)phenyl]acetate has a molecular weight of 480.38 g/mol, XLogP of 5.03, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-[(5-bromo-1,3-thiazol-2-yl)carbamoylamino]-2-(cyclopentanecarbonyl)phenyl]acetate is sourced from PubChem (CID 87230528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).