C70H68N4 — CID 87231287
5,15-bis[4-(4-prop-2-enylhepta-1,6-dien-4-yl)phenyl]-10,20-bis(2,4,6-trimethylphenyl)porphyrin (PubChem CID 87231287) has the molecular formula C70H68N4 and a molecular weight of 965.34 g/mol. Its IUPAC name is 5,15-bis[4-(4-prop-2-enylhepta-1,6-dien-4-yl)phenyl]-10,20-bis(2,4,6-trimethylphenyl)porphyrin.
| Compound Name | 5,15-bis[4-(4-prop-2-enylhepta-1,6-dien-4-yl)phenyl]-10,20-bis(2,4,6-trimethylphenyl)porphyrin |
|---|---|
| PubChem CID | 87231287 |
| Molecular Formula | C70H68N4 |
| Molecular Weight | 965.34 g/mol |
| Exact Mass | 964.54 |
| IUPAC Name | 5,15-bis[4-(4-prop-2-enylhepta-1,6-dien-4-yl)phenyl]-10,20-bis(2,4,6-trimethylphenyl)porphyrin |
| SMILES | C=CCC(CC=C)(CC=C)c1ccc(/C2=C3\C=CC(=N3)/C(c3c(C)cc(C)cc3C)=C3/C=CC(=N3)/C(c3ccc(C(CC=C)(CC=C)CC=C)cc3)=C3/C=CC(=N3)/C(c3c(C)cc(C)cc3C)=C3/C=CC2=N3)cc1 |
| InChI | InChI=1S/C70H68N4/c1-13-35-69(36-14-2,37-15-3)53-23-19-51(20-24-53)65-55-27-31-59(71-55)67(63-47(9)41-45(7)42-48(63)10)61-33-29-57(73-61)66(52-21-25-54(26-22-52)70(38-16-4,39-17-5)40-18-6)58-30-34-62(74-58)68(60-32-28-56(65)72-60)64-49(11)43-46(8)44-50(64)12/h13-34,41-44H,1-6,35-40H2,7-12H3/b65-55-,65-56-,66-57-,66-58-,67-59+,67-61+,68-60+,68-62+ |
| InChIKey | DSMZVTVANCALIQ-LNWONSRRSA-N |
| XLogP | 17.47 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.34 |
| LogP ≤ 5 | 17.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|