About 3-[1-(2,3-dihydroxypropoxy)butoxy]propane-1,2-diol
3-[1-(2,3-dihydroxypropoxy)butoxy]propane-1,2-diol (PubChem CID 87231822) has the molecular formula C10H22O6
and a molecular weight of 238.28 g/mol. Its IUPAC name is 3-[1-(2,3-dihydroxypropoxy)butoxy]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[1-(2,3-dihydroxypropoxy)butoxy]propane-1,2-diol |
| PubChem CID | 87231822 |
| Molecular Formula | C10H22O6 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 3-[1-(2,3-dihydroxypropoxy)butoxy]propane-1,2-diol |
| SMILES | CCCC(OCC(O)CO)OCC(O)CO |
| InChI | InChI=1S/C10H22O6/c1-2-3-10(15-6-8(13)4-11)16-7-9(14)5-12/h8-14H,2-7H2,1H3 |
| InChIKey | RDJIARNQYVDKNY-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(2,3-dihydroxypropoxy)butoxy]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,3-dihydroxypropoxy)butoxy]propane-1,2-diol?
The IUPAC name of 3-[1-(2,3-dihydroxypropoxy)butoxy]propane-1,2-diol (CID 87231822) is 3-[1-(2,3-dihydroxypropoxy)butoxy]propane-1,2-diol.
What is the SMILES notation for 3-[1-(2,3-dihydroxypropoxy)butoxy]propane-1,2-diol?
The canonical SMILES for 3-[1-(2,3-dihydroxypropoxy)butoxy]propane-1,2-diol is CCCC(OCC(O)CO)OCC(O)CO.
What is the InChIKey of 3-[1-(2,3-dihydroxypropoxy)butoxy]propane-1,2-diol?
The InChIKey is RDJIARNQYVDKNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O6/c1-2-3-10(15-6-8(13)4-11)16-7-9(14)5-12/h8-14H,2-7H2,1H3.
What are the key properties of 3-[1-(2,3-dihydroxypropoxy)butoxy]propane-1,2-diol?
3-[1-(2,3-dihydroxypropoxy)butoxy]propane-1,2-diol has a molecular weight of 238.28 g/mol, XLogP of -1.15, 10 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,3-dihydroxypropoxy)butoxy]propane-1,2-diol is sourced from PubChem (CID 87231822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).