C8H18ClNO2 — CID 87231890
1-chloro-3-(2-methylprop-2-enoxy)propan-2-ol;methanamine (PubChem CID 87231890) has the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. Its IUPAC name is 1-chloro-3-(2-methylprop-2-enoxy)propan-2-ol;methanamine.
| Compound Name | 1-chloro-3-(2-methylprop-2-enoxy)propan-2-ol;methanamine |
|---|---|
| PubChem CID | 87231890 |
| Molecular Formula | C8H18ClNO2 |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 1-chloro-3-(2-methylprop-2-enoxy)propan-2-ol;methanamine |
| SMILES | C=C(C)COCC(O)CCl.CN |
| InChI | InChI=1S/C7H13ClO2.CH5N/c1-6(2)4-10-5-7(9)3-8;1-2/h7,9H,1,3-5H2,2H3;2H2,1H3 |
| InChIKey | NQMXEHRCDGPXBR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|