About (4-oxo-1-adamantyl)oxycarbonyl difluoromethanesulfonate;triphenylsulfanium
(4-oxo-1-adamantyl)oxycarbonyl difluoromethanesulfonate;triphenylsulfanium (PubChem CID 87232334) has the molecular formula C30H29F2O6S2+
and a molecular weight of 587.69 g/mol. Its IUPAC name is (4-oxo-1-adamantyl)oxycarbonyl difluoromethanesulfonate;triphenylsulfanium.
Molecular Properties
| Compound Name | (4-oxo-1-adamantyl)oxycarbonyl difluoromethanesulfonate;triphenylsulfanium |
| PubChem CID | 87232334 |
| Molecular Formula | C30H29F2O6S2+ |
| Molecular Weight | 587.69 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | (4-oxo-1-adamantyl)oxycarbonyl difluoromethanesulfonate;triphenylsulfanium |
| SMILES | O=C(OC12CC3CC(C1)C(=O)C(C3)C2)OS(=O)(=O)C(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C12H14F2O6S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;13-10(14)21(17,18)20-11(16)19-12-3-6-1-7(4-12)9(15)8(2-6)5-12/h1-15H;6-8,10H,1-5H2/q+1; |
| InChIKey | UOLKHWDODMKSRM-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 587.69 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-oxo-1-adamantyl)oxycarbonyl difluoromethanesulfonate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-1-adamantyl)oxycarbonyl difluoromethanesulfonate;triphenylsulfanium?
The IUPAC name of (4-oxo-1-adamantyl)oxycarbonyl difluoromethanesulfonate;triphenylsulfanium (CID 87232334) is (4-oxo-1-adamantyl)oxycarbonyl difluoromethanesulfonate;triphenylsulfanium.
What is the SMILES notation for (4-oxo-1-adamantyl)oxycarbonyl difluoromethanesulfonate;triphenylsulfanium?
The canonical SMILES for (4-oxo-1-adamantyl)oxycarbonyl difluoromethanesulfonate;triphenylsulfanium is O=C(OC12CC3CC(C1)C(=O)C(C3)C2)OS(=O)(=O)C(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (4-oxo-1-adamantyl)oxycarbonyl difluoromethanesulfonate;triphenylsulfanium?
The InChIKey is UOLKHWDODMKSRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15S.C12H14F2O6S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;13-10(14)21(17,18)20-11(16)19-12-3-6-1-7(4-12)9(15)8(2-6)5-12/h1-15H;6-8,10H,1-5H2/q+1;.
What are the key properties of (4-oxo-1-adamantyl)oxycarbonyl difluoromethanesulfonate;triphenylsulfanium?
(4-oxo-1-adamantyl)oxycarbonyl difluoromethanesulfonate;triphenylsulfanium has a molecular weight of 587.69 g/mol, XLogP of 6.62, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-1-adamantyl)oxycarbonyl difluoromethanesulfonate;triphenylsulfanium is sourced from PubChem (CID 87232334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).