About 1-triethoxysilylpropane-1-sulfonic acid;triphenylsulfanium
1-triethoxysilylpropane-1-sulfonic acid;triphenylsulfanium (PubChem CID 87232460) has the molecular formula C27H37O6S2Si+
and a molecular weight of 549.81 g/mol. Its IUPAC name is 1-triethoxysilylpropane-1-sulfonic acid;triphenylsulfanium.
Molecular Properties
| Compound Name | 1-triethoxysilylpropane-1-sulfonic acid;triphenylsulfanium |
| PubChem CID | 87232460 |
| Molecular Formula | C27H37O6S2Si+ |
| Molecular Weight | 549.81 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 1-triethoxysilylpropane-1-sulfonic acid;triphenylsulfanium |
| SMILES | CCO[Si](OCC)(OCC)C(CC)S(=O)(=O)O.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C9H22O6SSi/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5-9(16(10,11)12)17(13-6-2,14-7-3)15-8-4/h1-15H;9H,5-8H2,1-4H3,(H,10,11,12)/q+1; |
| InChIKey | ASTGWVHNKRCESF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 549.81 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-triethoxysilylpropane-1-sulfonic acid;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-triethoxysilylpropane-1-sulfonic acid;triphenylsulfanium?
The IUPAC name of 1-triethoxysilylpropane-1-sulfonic acid;triphenylsulfanium (CID 87232460) is 1-triethoxysilylpropane-1-sulfonic acid;triphenylsulfanium.
What is the SMILES notation for 1-triethoxysilylpropane-1-sulfonic acid;triphenylsulfanium?
The canonical SMILES for 1-triethoxysilylpropane-1-sulfonic acid;triphenylsulfanium is CCO[Si](OCC)(OCC)C(CC)S(=O)(=O)O.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1-triethoxysilylpropane-1-sulfonic acid;triphenylsulfanium?
The InChIKey is ASTGWVHNKRCESF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15S.C9H22O6SSi/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5-9(16(10,11)12)17(13-6-2,14-7-3)15-8-4/h1-15H;9H,5-8H2,1-4H3,(H,10,11,12)/q+1;.
What are the key properties of 1-triethoxysilylpropane-1-sulfonic acid;triphenylsulfanium?
1-triethoxysilylpropane-1-sulfonic acid;triphenylsulfanium has a molecular weight of 549.81 g/mol, XLogP of 6.02, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-triethoxysilylpropane-1-sulfonic acid;triphenylsulfanium is sourced from PubChem (CID 87232460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).