C32H42F4O7S2 — CID 87233162
1-(4-butoxynaphthalen-1-yl)thiolan-1-ium;1,1,2,2-tetrafluoro-2-[6-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-bicyclo[2.2.1]heptanyl]ethanesulfonate (PubChem CID 87233162) has the molecular formula C32H42F4O7S2 and a molecular weight of 678.81 g/mol. Its IUPAC name is 1-(4-butoxynaphthalen-1-yl)thiolan-1-ium;1,1,2,2-tetrafluoro-2-[6-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-bicyclo[2.2.1]heptanyl]ethanesulfonate.
| Compound Name | 1-(4-butoxynaphthalen-1-yl)thiolan-1-ium;1,1,2,2-tetrafluoro-2-[6-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-bicyclo[2.2.1]heptanyl]ethanesulfonate |
|---|---|
| PubChem CID | 87233162 |
| Molecular Formula | C32H42F4O7S2 |
| Molecular Weight | 678.81 g/mol |
| Exact Mass | 678.23 |
| IUPAC Name | 1-(4-butoxynaphthalen-1-yl)thiolan-1-ium;1,1,2,2-tetrafluoro-2-[6-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-bicyclo[2.2.1]heptanyl]ethanesulfonate |
| SMILES | CC(C)(C)OC(=O)OC1CC2CC1C(C(F)(F)C(F)(F)S(=O)(=O)[O-])C2.CCCCOc1ccc([S+]2CCCC2)c2ccccc12 |
| InChI | InChI=1S/C18H23OS.C14H20F4O6S/c1-2-3-12-19-17-10-11-18(20-13-6-7-14-20)16-9-5-4-8-15(16)17;1-12(2,3)24-11(19)23-10-6-7-4-8(10)9(5-7)13(15,16)14(17,18)25(20,21)22/h4-5,8-11H,2-3,6-7,12-14H2,1H3;7-10H,4-6H2,1-3H3,(H,20,21,22)/q+1;/p-1 |
| InChIKey | VENFLBNYESHJKZ-UHFFFAOYSA-M |
| XLogP | 7.92 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.81 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|