C32H42F4O7S2 — CID 87233164
[1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-[6-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-bicyclo[2.2.1]heptanyl]ethanesulfonate (PubChem CID 87233164) has the molecular formula C32H42F4O7S2 and a molecular weight of 678.81 g/mol. Its IUPAC name is [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-[6-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-bicyclo[2.2.1]heptanyl]ethanesulfonate.
| Compound Name | [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-[6-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-bicyclo[2.2.1]heptanyl]ethanesulfonate |
|---|---|
| PubChem CID | 87233164 |
| Molecular Formula | C32H42F4O7S2 |
| Molecular Weight | 678.81 g/mol |
| Exact Mass | 678.23 |
| IUPAC Name | [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-[6-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-bicyclo[2.2.1]heptanyl]ethanesulfonate |
| SMILES | CCCCOc1ccc(S2(OS(=O)(=O)C(F)(F)C(F)(F)C3CC4CC(OC(=O)OC(C)(C)C)C3C4)CCCC2)c2ccccc12 |
| InChI | InChI=1S/C32H42F4O7S2/c1-5-6-15-40-26-13-14-28(23-12-8-7-11-22(23)26)44(16-9-10-17-44)43-45(38,39)32(35,36)31(33,34)25-19-21-18-24(25)27(20-21)41-29(37)42-30(2,3)4/h7-8,11-14,21,24-25,27H,5-6,9-10,15-20H2,1-4H3 |
| InChIKey | IUBDIGXORWOZGV-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.81 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|