C28H50F8O — CID 87233229
7,7,8,8-tetrafluoro-1-(7,7,8,8-tetrafluorotetradecoxy)tetradecane (PubChem CID 87233229) has the molecular formula C28H50F8O and a molecular weight of 554.69 g/mol. Its IUPAC name is 7,7,8,8-tetrafluoro-1-(7,7,8,8-tetrafluorotetradecoxy)tetradecane.
| Compound Name | 7,7,8,8-tetrafluoro-1-(7,7,8,8-tetrafluorotetradecoxy)tetradecane |
|---|---|
| PubChem CID | 87233229 |
| Molecular Formula | C28H50F8O |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.37 |
| IUPAC Name | 7,7,8,8-tetrafluoro-1-(7,7,8,8-tetrafluorotetradecoxy)tetradecane |
| SMILES | CCCCCCC(F)(F)C(F)(F)CCCCCCOCCCCCCC(F)(F)C(F)(F)CCCCCC |
| InChI | InChI=1S/C28H50F8O/c1-3-5-7-13-19-25(29,30)27(33,34)21-15-9-11-17-23-37-24-18-12-10-16-22-28(35,36)26(31,32)20-14-8-6-4-2/h3-24H2,1-2H3 |
| InChIKey | PWXUDOYOCCTMGT-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|