About dibutyltin;diethyl (Z)-but-2-enedioate
dibutyltin;diethyl (Z)-but-2-enedioate (PubChem CID 87233994) has the molecular formula C16H30O4Sn
and a molecular weight of 405.12 g/mol. Its IUPAC name is dibutyltin;diethyl (Z)-but-2-enedioate.
Molecular Properties
| Compound Name | dibutyltin;diethyl (Z)-but-2-enedioate |
| PubChem CID | 87233994 |
| Molecular Formula | C16H30O4Sn |
| Molecular Weight | 405.12 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | dibutyltin;diethyl (Z)-but-2-enedioate |
| SMILES | CCCC[Sn]CCCC.CCOC(=O)/C=C\C(=O)OCC |
| InChI | InChI=1S/C8H12O4.2C4H9.Sn/c1-3-11-7(9)5-6-8(10)12-4-2;2*1-3-4-2;/h5-6H,3-4H2,1-2H3;2*1,3-4H2,2H3;/b6-5-;;; |
| InChIKey | NVOGEOJJWIEKGO-WTUPQPTJSA-N |
| XLogP | 3.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.12 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dibutyltin;diethyl (Z)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyltin;diethyl (Z)-but-2-enedioate?
The IUPAC name of dibutyltin;diethyl (Z)-but-2-enedioate (CID 87233994) is dibutyltin;diethyl (Z)-but-2-enedioate.
What is the SMILES notation for dibutyltin;diethyl (Z)-but-2-enedioate?
The canonical SMILES for dibutyltin;diethyl (Z)-but-2-enedioate is CCCC[Sn]CCCC.CCOC(=O)/C=C\C(=O)OCC.
What is the InChIKey of dibutyltin;diethyl (Z)-but-2-enedioate?
The InChIKey is NVOGEOJJWIEKGO-WTUPQPTJSA-N. The full InChI is InChI=1S/C8H12O4.2C4H9.Sn/c1-3-11-7(9)5-6-8(10)12-4-2;2*1-3-4-2;/h5-6H,3-4H2,1-2H3;2*1,3-4H2,2H3;/b6-5-;;;.
What are the key properties of dibutyltin;diethyl (Z)-but-2-enedioate?
dibutyltin;diethyl (Z)-but-2-enedioate has a molecular weight of 405.12 g/mol, XLogP of 3.80, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyltin;diethyl (Z)-but-2-enedioate is sourced from PubChem (CID 87233994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).