C26H33N3O5 — CID 87234518
(6S,7S)-2-cyclohexyl-7-(hydroxycarbamoyl)-6-(3-phenyl-2,5-dihydropyrrole-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylic acid (PubChem CID 87234518) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is (6S,7S)-2-cyclohexyl-7-(hydroxycarbamoyl)-6-(3-phenyl-2,5-dihydropyrrole-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylic acid.
| Compound Name | (6S,7S)-2-cyclohexyl-7-(hydroxycarbamoyl)-6-(3-phenyl-2,5-dihydropyrrole-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylic acid |
|---|---|
| PubChem CID | 87234518 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | (6S,7S)-2-cyclohexyl-7-(hydroxycarbamoyl)-6-(3-phenyl-2,5-dihydropyrrole-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylic acid |
| SMILES | O=C(NO)[C@H]1CC2(CC2C2CCCCC2)CN(C(=O)O)[C@@H]1C(=O)N1CC=C(c2ccccc2)C1 |
| InChI | InChI=1S/C26H33N3O5/c30-23(27-34)20-13-26(14-21(26)18-9-5-2-6-10-18)16-29(25(32)33)22(20)24(31)28-12-11-19(15-28)17-7-3-1-4-8-17/h1,3-4,7-8,11,18,20-22,34H,2,5-6,9-10,12-16H2,(H,27,30)(H,32,33)/t20-,21?,22-,26?/m0/s1 |
| InChIKey | PVXAYLGSHYDLHS-KBBJCZRKSA-N |
| XLogP | 3.37 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|