C21H27F2N3O5S — CID 87234802
(6S,7S)-6-[4-(3,5-difluorophenyl)piperidine-1-carbonyl]-N-hydroxy-5-methylsulfonyl-5-azaspiro[2.5]octane-7-carboxamide (PubChem CID 87234802) has the molecular formula C21H27F2N3O5S and a molecular weight of 471.53 g/mol. Its IUPAC name is (6S,7S)-6-[4-(3,5-difluorophenyl)piperidine-1-carbonyl]-N-hydroxy-5-methylsulfonyl-5-azaspiro[2.5]octane-7-carboxamide.
| Compound Name | (6S,7S)-6-[4-(3,5-difluorophenyl)piperidine-1-carbonyl]-N-hydroxy-5-methylsulfonyl-5-azaspiro[2.5]octane-7-carboxamide |
|---|---|
| PubChem CID | 87234802 |
| Molecular Formula | C21H27F2N3O5S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | (6S,7S)-6-[4-(3,5-difluorophenyl)piperidine-1-carbonyl]-N-hydroxy-5-methylsulfonyl-5-azaspiro[2.5]octane-7-carboxamide |
| SMILES | CS(=O)(=O)N1CC2(CC2)C[C@H](C(=O)NO)[C@H]1C(=O)N1CCC(c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C21H27F2N3O5S/c1-32(30,31)26-12-21(4-5-21)11-17(19(27)24-29)18(26)20(28)25-6-2-13(3-7-25)14-8-15(22)10-16(23)9-14/h8-10,13,17-18,29H,2-7,11-12H2,1H3,(H,24,27)/t17-,18-/m0/s1 |
| InChIKey | LCDIQGQOABILMC-ROUUACIJSA-N |
| XLogP | 1.61 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|