C21H8N4O12S2 — CID 87235093
1,3-bis(6,8-dinitro-2-oxothiochromen-3-yl)propane-1,3-dione (PubChem CID 87235093) has the molecular formula C21H8N4O12S2 and a molecular weight of 572.45 g/mol. Its IUPAC name is 1,3-bis(6,8-dinitro-2-oxothiochromen-3-yl)propane-1,3-dione.
| Compound Name | 1,3-bis(6,8-dinitro-2-oxothiochromen-3-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 87235093 |
| Molecular Formula | C21H8N4O12S2 |
| Molecular Weight | 572.45 g/mol |
| Exact Mass | 571.96 |
| IUPAC Name | 1,3-bis(6,8-dinitro-2-oxothiochromen-3-yl)propane-1,3-dione |
| SMILES | O=C(CC(=O)c1cc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2sc1=O)c1cc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2sc1=O |
| InChI | InChI=1S/C21H8N4O12S2/c26-16(12-3-8-1-10(22(30)31)5-14(24(34)35)18(8)38-20(12)28)7-17(27)13-4-9-2-11(23(32)33)6-15(25(36)37)19(9)39-21(13)29/h1-6H,7H2 |
| InChIKey | AXKNOERXEYMAMV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 240.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|