C11H16N4O4S — CID 87235196
9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-sulfanyloxolan-2-yl]-6-methyl-8H-purin-6-ol (PubChem CID 87235196) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-sulfanyloxolan-2-yl]-6-methyl-8H-purin-6-ol.
| Compound Name | 9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-sulfanyloxolan-2-yl]-6-methyl-8H-purin-6-ol |
|---|---|
| PubChem CID | 87235196 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-sulfanyloxolan-2-yl]-6-methyl-8H-purin-6-ol |
| SMILES | CC1(O)N=CN=C2C1=NCN2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1S |
| InChI | InChI=1S/C11H16N4O4S/c1-11(18)8-9(12-3-14-11)15(4-13-8)10-7(20)6(17)5(2-16)19-10/h3,5-7,10,16-18,20H,2,4H2,1H3/t5-,6-,7-,10-,11?/m1/s1 |
| InChIKey | TYGQZJGOHMNYGN-SPIULWCRSA-N |
| XLogP | -1.77 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|