About 2-methylprop-2-enoic acid;oxido(prop-2-enyl)azanium
2-methylprop-2-enoic acid;oxido(prop-2-enyl)azanium (PubChem CID 87235544) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;oxido(prop-2-enyl)azanium.
Molecular Properties
| Compound Name | 2-methylprop-2-enoic acid;oxido(prop-2-enyl)azanium |
| PubChem CID | 87235544 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 2-methylprop-2-enoic acid;oxido(prop-2-enyl)azanium |
| SMILES | C=C(C)C(=O)O.C=CC[NH2+][O-] |
| InChI | InChI=1S/C4H6O2.C3H7NO/c1-3(2)4(5)6;1-2-3-4-5/h1H2,2H3,(H,5,6);2H,1,3-4H2 |
| InChIKey | ZMJIJBKUFABWKP-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoic acid;oxido(prop-2-enyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoic acid;oxido(prop-2-enyl)azanium?
The IUPAC name of 2-methylprop-2-enoic acid;oxido(prop-2-enyl)azanium (CID 87235544) is 2-methylprop-2-enoic acid;oxido(prop-2-enyl)azanium.
What is the SMILES notation for 2-methylprop-2-enoic acid;oxido(prop-2-enyl)azanium?
The canonical SMILES for 2-methylprop-2-enoic acid;oxido(prop-2-enyl)azanium is C=C(C)C(=O)O.C=CC[NH2+][O-].
What is the InChIKey of 2-methylprop-2-enoic acid;oxido(prop-2-enyl)azanium?
The InChIKey is ZMJIJBKUFABWKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C3H7NO/c1-3(2)4(5)6;1-2-3-4-5/h1H2,2H3,(H,5,6);2H,1,3-4H2.
What are the key properties of 2-methylprop-2-enoic acid;oxido(prop-2-enyl)azanium?
2-methylprop-2-enoic acid;oxido(prop-2-enyl)azanium has a molecular weight of 159.18 g/mol, XLogP of -0.12, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoic acid;oxido(prop-2-enyl)azanium is sourced from PubChem (CID 87235544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).