About (2S)-2-aminopentanedioic acid;(E)-but-2-enedioic acid
(2S)-2-aminopentanedioic acid;(E)-but-2-enedioic acid (PubChem CID 87236668) has the molecular formula C9H13NO8
and a molecular weight of 263.20 g/mol. Its IUPAC name is (2S)-2-aminopentanedioic acid;(E)-but-2-enedioic acid.
Molecular Properties
| Compound Name | (2S)-2-aminopentanedioic acid;(E)-but-2-enedioic acid |
| PubChem CID | 87236668 |
| Molecular Formula | C9H13NO8 |
| Molecular Weight | 263.20 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | (2S)-2-aminopentanedioic acid;(E)-but-2-enedioic acid |
| SMILES | N[C@@H](CCC(=O)O)C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C5H9NO4.C4H4O4/c6-3(5(9)10)1-2-4(7)8;5-3(6)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10);1-2H,(H,5,6)(H,7,8)/b;2-1+/t3-;/m0./s1 |
| InChIKey | NYBPFKCUSHIQDN-HYUTVRSWSA-N |
| XLogP | -1.03 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.20 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminopentanedioic acid;(E)-but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopentanedioic acid;(E)-but-2-enedioic acid?
The IUPAC name of (2S)-2-aminopentanedioic acid;(E)-but-2-enedioic acid (CID 87236668) is (2S)-2-aminopentanedioic acid;(E)-but-2-enedioic acid.
What is the SMILES notation for (2S)-2-aminopentanedioic acid;(E)-but-2-enedioic acid?
The canonical SMILES for (2S)-2-aminopentanedioic acid;(E)-but-2-enedioic acid is N[C@@H](CCC(=O)O)C(=O)O.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (2S)-2-aminopentanedioic acid;(E)-but-2-enedioic acid?
The InChIKey is NYBPFKCUSHIQDN-HYUTVRSWSA-N. The full InChI is InChI=1S/C5H9NO4.C4H4O4/c6-3(5(9)10)1-2-4(7)8;5-3(6)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10);1-2H,(H,5,6)(H,7,8)/b;2-1+/t3-;/m0./s1.
What are the key properties of (2S)-2-aminopentanedioic acid;(E)-but-2-enedioic acid?
(2S)-2-aminopentanedioic acid;(E)-but-2-enedioic acid has a molecular weight of 263.20 g/mol, XLogP of -1.03, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopentanedioic acid;(E)-but-2-enedioic acid is sourced from PubChem (CID 87236668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).