C16H23NNa2O7S2 — CID 87237578
disodium;3-[7-methoxy-2,2-dimethyl-4-(sulfonatomethyl)-3,4-dihydroquinolin-1-yl]propane-1-sulfonate (PubChem CID 87237578) has the molecular formula C16H23NNa2O7S2 and a molecular weight of 451.47 g/mol. Its IUPAC name is disodium;3-[7-methoxy-2,2-dimethyl-4-(sulfonatomethyl)-3,4-dihydroquinolin-1-yl]propane-1-sulfonate.
| Compound Name | disodium;3-[7-methoxy-2,2-dimethyl-4-(sulfonatomethyl)-3,4-dihydroquinolin-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 87237578 |
| Molecular Formula | C16H23NNa2O7S2 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | disodium;3-[7-methoxy-2,2-dimethyl-4-(sulfonatomethyl)-3,4-dihydroquinolin-1-yl]propane-1-sulfonate |
| SMILES | COc1ccc2c(c1)N(CCCS(=O)(=O)[O-])C(C)(C)CC2CS(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C16H25NO7S2.2Na/c1-16(2)10-12(11-26(21,22)23)14-6-5-13(24-3)9-15(14)17(16)7-4-8-25(18,19)20;;/h5-6,9,12H,4,7-8,10-11H2,1-3H3,(H,18,19,20)(H,21,22,23);;/q;2*+1/p-2 |
| InChIKey | FCNSFXQQGPOAKR-UHFFFAOYSA-L |
| XLogP | -4.74 |
| TPSA | 126.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|