About 2-(bromomethyl)oxirane;1-(1,3-dibromopropan-2-yloxy)-2-methylbenzene
2-(bromomethyl)oxirane;1-(1,3-dibromopropan-2-yloxy)-2-methylbenzene (PubChem CID 87237783) has the molecular formula C13H17Br3O2
and a molecular weight of 444.99 g/mol. Its IUPAC name is 2-(bromomethyl)oxirane;1-(1,3-dibromopropan-2-yloxy)-2-methylbenzene.
Molecular Properties
| Compound Name | 2-(bromomethyl)oxirane;1-(1,3-dibromopropan-2-yloxy)-2-methylbenzene |
| PubChem CID | 87237783 |
| Molecular Formula | C13H17Br3O2 |
| Molecular Weight | 444.99 g/mol |
| Exact Mass | 441.88 |
| IUPAC Name | 2-(bromomethyl)oxirane;1-(1,3-dibromopropan-2-yloxy)-2-methylbenzene |
| SMILES | BrCC1CO1.Cc1ccccc1OC(CBr)CBr |
| InChI | InChI=1S/C10H12Br2O.C3H5BrO/c1-8-4-2-3-5-10(8)13-9(6-11)7-12;4-1-3-2-5-3/h2-5,9H,6-7H2,1H3;3H,1-2H2 |
| InChIKey | IZSUGSLYRZCSHT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.99 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)oxirane;1-(1,3-dibromopropan-2-yloxy)-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)oxirane;1-(1,3-dibromopropan-2-yloxy)-2-methylbenzene?
The IUPAC name of 2-(bromomethyl)oxirane;1-(1,3-dibromopropan-2-yloxy)-2-methylbenzene (CID 87237783) is 2-(bromomethyl)oxirane;1-(1,3-dibromopropan-2-yloxy)-2-methylbenzene.
What is the SMILES notation for 2-(bromomethyl)oxirane;1-(1,3-dibromopropan-2-yloxy)-2-methylbenzene?
The canonical SMILES for 2-(bromomethyl)oxirane;1-(1,3-dibromopropan-2-yloxy)-2-methylbenzene is BrCC1CO1.Cc1ccccc1OC(CBr)CBr.
What is the InChIKey of 2-(bromomethyl)oxirane;1-(1,3-dibromopropan-2-yloxy)-2-methylbenzene?
The InChIKey is IZSUGSLYRZCSHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Br2O.C3H5BrO/c1-8-4-2-3-5-10(8)13-9(6-11)7-12;4-1-3-2-5-3/h2-5,9H,6-7H2,1H3;3H,1-2H2.
What are the key properties of 2-(bromomethyl)oxirane;1-(1,3-dibromopropan-2-yloxy)-2-methylbenzene?
2-(bromomethyl)oxirane;1-(1,3-dibromopropan-2-yloxy)-2-methylbenzene has a molecular weight of 444.99 g/mol, XLogP of 4.31, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)oxirane;1-(1,3-dibromopropan-2-yloxy)-2-methylbenzene is sourced from PubChem (CID 87237783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).