About 2-methylprop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate
2-methylprop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate (PubChem CID 87238021) has the molecular formula C17H36O7Si3
and a molecular weight of 436.73 g/mol. Its IUPAC name is 2-methylprop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate.
Molecular Properties
| Compound Name | 2-methylprop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate |
| PubChem CID | 87238021 |
| Molecular Formula | C17H36O7Si3 |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-methylprop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate |
| SMILES | C=C(C)C(=O)OC(=O)C(O)(C(O)CCC)[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H36O7Si3/c1-11-12-14(18)17(21,16(20)22-15(19)13(2)3)27(10,23-25(4,5)6)24-26(7,8)9/h14,18,21H,2,11-12H2,1,3-10H3 |
| InChIKey | MEOZIGNECINTJE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate?
The IUPAC name of 2-methylprop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate (CID 87238021) is 2-methylprop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate.
What is the SMILES notation for 2-methylprop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate?
The canonical SMILES for 2-methylprop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate is C=C(C)C(=O)OC(=O)C(O)(C(O)CCC)[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of 2-methylprop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate?
The InChIKey is MEOZIGNECINTJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O7Si3/c1-11-12-14(18)17(21,16(20)22-15(19)13(2)3)27(10,23-25(4,5)6)24-26(7,8)9/h14,18,21H,2,11-12H2,1,3-10H3.
What are the key properties of 2-methylprop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate?
2-methylprop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate has a molecular weight of 436.73 g/mol, XLogP of 2.84, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoyl 2,3-dihydroxy-2-[methyl-bis(trimethylsilyloxy)silyl]hexanoate is sourced from PubChem (CID 87238021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).