C27H30ClN3O3 — CID 87238230
2-[(1S)-5-[3-[[2-chloro-5-(4-ethylphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid (PubChem CID 87238230) has the molecular formula C27H30ClN3O3 and a molecular weight of 480.01 g/mol. Its IUPAC name is 2-[(1S)-5-[3-[[2-chloro-5-(4-ethylphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid.
| Compound Name | 2-[(1S)-5-[3-[[2-chloro-5-(4-ethylphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 87238230 |
| Molecular Formula | C27H30ClN3O3 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 2-[(1S)-5-[3-[[2-chloro-5-(4-ethylphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
| SMILES | CCc1ccc(-c2cnc(Cl)nc2N(C)CCCOc2ccc3c(c2)CC[C@H]3CC(=O)O)cc1 |
| InChI | InChI=1S/C27H30ClN3O3/c1-3-18-5-7-19(8-6-18)24-17-29-27(28)30-26(24)31(2)13-4-14-34-22-11-12-23-20(15-22)9-10-21(23)16-25(32)33/h5-8,11-12,15,17,21H,3-4,9-10,13-14,16H2,1-2H3,(H,32,33)/t21-/m0/s1 |
| InChIKey | RGHSLPXKHIICMZ-NRFANRHFSA-N |
| XLogP | 5.77 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|