C16H30O3 — CID 87238261
oxirane;5,5,6-trimethylundec-3-yne-2,2-diol (PubChem CID 87238261) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is oxirane;5,5,6-trimethylundec-3-yne-2,2-diol.
| Compound Name | oxirane;5,5,6-trimethylundec-3-yne-2,2-diol |
|---|---|
| PubChem CID | 87238261 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | oxirane;5,5,6-trimethylundec-3-yne-2,2-diol |
| SMILES | C1CO1.CCCCCC(C)C(C)(C)C#CC(C)(O)O |
| InChI | InChI=1S/C14H26O2.C2H4O/c1-6-7-8-9-12(2)13(3,4)10-11-14(5,15)16;1-2-3-1/h12,15-16H,6-9H2,1-5H3;1-2H2 |
| InChIKey | ONMVSVIZFZODEG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|