About ethane-1,2-diol;prop-2-enyl hydrogen carbonate
ethane-1,2-diol;prop-2-enyl hydrogen carbonate (PubChem CID 87239089) has the molecular formula C6H12O5
and a molecular weight of 164.16 g/mol. Its IUPAC name is ethane-1,2-diol;prop-2-enyl hydrogen carbonate.
Molecular Properties
| Compound Name | ethane-1,2-diol;prop-2-enyl hydrogen carbonate |
| PubChem CID | 87239089 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | ethane-1,2-diol;prop-2-enyl hydrogen carbonate |
| SMILES | C=CCOC(=O)O.OCCO |
| InChI | InChI=1S/C4H6O3.C2H6O2/c1-2-3-7-4(5)6;3-1-2-4/h2H,1,3H2,(H,5,6);3-4H,1-2H2 |
| InChIKey | JFMDOICYUBWQBX-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,2-diol;prop-2-enyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;prop-2-enyl hydrogen carbonate?
The IUPAC name of ethane-1,2-diol;prop-2-enyl hydrogen carbonate (CID 87239089) is ethane-1,2-diol;prop-2-enyl hydrogen carbonate.
What is the SMILES notation for ethane-1,2-diol;prop-2-enyl hydrogen carbonate?
The canonical SMILES for ethane-1,2-diol;prop-2-enyl hydrogen carbonate is C=CCOC(=O)O.OCCO.
What is the InChIKey of ethane-1,2-diol;prop-2-enyl hydrogen carbonate?
The InChIKey is JFMDOICYUBWQBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.C2H6O2/c1-2-3-7-4(5)6;3-1-2-4/h2H,1,3H2,(H,5,6);3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;prop-2-enyl hydrogen carbonate?
ethane-1,2-diol;prop-2-enyl hydrogen carbonate has a molecular weight of 164.16 g/mol, XLogP of -0.16, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;prop-2-enyl hydrogen carbonate is sourced from PubChem (CID 87239089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).