C48H56N12+4 — CID 87239599
5,10,15,20-tetrakis(1,3-diethylimidazol-1-ium-2-yl)porphyrin (PubChem CID 87239599) has the molecular formula C48H56N12+4 and a molecular weight of 801.06 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(1,3-diethylimidazol-1-ium-2-yl)porphyrin.
| Compound Name | 5,10,15,20-tetrakis(1,3-diethylimidazol-1-ium-2-yl)porphyrin |
|---|---|
| PubChem CID | 87239599 |
| Molecular Formula | C48H56N12+4 |
| Molecular Weight | 801.06 g/mol |
| Exact Mass | 800.47 |
| IUPAC Name | 5,10,15,20-tetrakis(1,3-diethylimidazol-1-ium-2-yl)porphyrin |
| SMILES | CCn1cc[n+](CC)c1/C1=C2\C=CC(=N2)/C(c2n(CC)cc[n+]2CC)=C2/C=CC(=N2)/C(c2n(CC)cc[n+]2CC)=C2/C=CC(=N2)/C(c2n(CC)cc[n+]2CC)=C2/C=CC1=N2 |
| InChI | InChI=1S/C48H56N12/c1-9-53-25-26-54(10-2)45(53)41-33-17-19-35(49-33)42(46-55(11-3)27-28-56(46)12-4)37-21-23-39(51-37)44(48-59(15-7)31-32-60(48)16-8)40-24-22-38(52-40)43(36-20-18-34(41)50-36)47-57(13-5)29-30-58(47)14-6/h17-32H,9-16H2,1-8H3/q+4/b41-33+,41-34+,42-35+,42-37+,43-36+,43-38+,44-39+,44-40+ |
| InChIKey | SCUKMGRCUUTVMS-WYGWEXIFSA-N |
| XLogP | 6.20 |
| TPSA | 84.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.06 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|