C30H26N8+2 — CID 87239713
5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)porphyrin (PubChem CID 87239713) has the molecular formula C30H26N8+2 and a molecular weight of 498.59 g/mol. Its IUPAC name is 5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)porphyrin.
| Compound Name | 5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)porphyrin |
|---|---|
| PubChem CID | 87239713 |
| Molecular Formula | C30H26N8+2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)porphyrin |
| SMILES | Cn1cc[n+](C)c1/C1=C2\C=CC(=N2)/C=C2/C=CC(=N2)/C(c2n(C)cc[n+]2C)=C2/C=CC(=N2)/C=C2/C=CC1=N2 |
| InChI | InChI=1S/C30H26N8/c1-35-13-14-36(2)29(35)27-23-9-5-19(31-23)17-21-7-11-25(33-21)28(30-37(3)15-16-38(30)4)26-12-8-22(34-26)18-20-6-10-24(27)32-20/h5-18H,1-4H3/q+2/b19-17-,20-18-,21-17-,22-18-,27-23+,27-24+,28-25+,28-26+ |
| InChIKey | OEROTXSVHOXZSV-TXOUBSANSA-N |
| XLogP | 2.96 |
| TPSA | 67.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|