About gold;propane-1,2,3-triol
gold;propane-1,2,3-triol (PubChem CID 87239797) has the molecular formula C3H8AuO3
and a molecular weight of 289.06 g/mol. Its IUPAC name is gold;propane-1,2,3-triol.
Molecular Properties
| Compound Name | gold;propane-1,2,3-triol |
| PubChem CID | 87239797 |
| Molecular Formula | C3H8AuO3 |
| Molecular Weight | 289.06 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | gold;propane-1,2,3-triol |
| SMILES | OCC(O)CO.[Au] |
| InChI | InChI=1S/C3H8O3.Au/c4-1-3(6)2-5;/h3-6H,1-2H2; |
| InChIKey | VWQSQUGKDAENEM-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.06 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze gold;propane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold;propane-1,2,3-triol?
The IUPAC name of gold;propane-1,2,3-triol (CID 87239797) is gold;propane-1,2,3-triol.
What is the SMILES notation for gold;propane-1,2,3-triol?
The canonical SMILES for gold;propane-1,2,3-triol is OCC(O)CO.[Au].
What is the InChIKey of gold;propane-1,2,3-triol?
The InChIKey is VWQSQUGKDAENEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O3.Au/c4-1-3(6)2-5;/h3-6H,1-2H2;.
What are the key properties of gold;propane-1,2,3-triol?
gold;propane-1,2,3-triol has a molecular weight of 289.06 g/mol, XLogP of -1.67, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for gold;propane-1,2,3-triol is sourced from PubChem (CID 87239797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).