C23H26N2O4 — CID 87239812
(2R)-2-cyclopentyl-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]-2-phenylacetic acid (PubChem CID 87239812) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (2R)-2-cyclopentyl-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]-2-phenylacetic acid.
| Compound Name | (2R)-2-cyclopentyl-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 87239812 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (2R)-2-cyclopentyl-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]-2-phenylacetic acid |
| SMILES | O=C(/C=C/c1ccc(CN[C@@](C(=O)O)(c2ccccc2)C2CCCC2)cc1)NO |
| InChI | InChI=1S/C23H26N2O4/c26-21(25-29)15-14-17-10-12-18(13-11-17)16-24-23(22(27)28,20-8-4-5-9-20)19-6-2-1-3-7-19/h1-3,6-7,10-15,20,24,29H,4-5,8-9,16H2,(H,25,26)(H,27,28)/b15-14+/t23-/m0/s1 |
| InChIKey | PJRPXMLFHDICIN-NSFRLNINSA-N |
| XLogP | 3.47 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|