About boric acid;N,N-dimethylmethanamine
boric acid;N,N-dimethylmethanamine (PubChem CID 87240079) has the molecular formula C3H12BNO3
and a molecular weight of 120.94 g/mol. Its IUPAC name is boric acid;N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | boric acid;N,N-dimethylmethanamine |
| PubChem CID | 87240079 |
| Molecular Formula | C3H12BNO3 |
| Molecular Weight | 120.94 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | boric acid;N,N-dimethylmethanamine |
| SMILES | CN(C)C.OB(O)O |
| InChI | InChI=1S/C3H9N.BH3O3/c1-4(2)3;2-1(3)4/h1-3H3;2-4H |
| InChIKey | LYSQGYSICZCRKO-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.94 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;N,N-dimethylmethanamine?
The IUPAC name of boric acid;N,N-dimethylmethanamine (CID 87240079) is boric acid;N,N-dimethylmethanamine.
What is the SMILES notation for boric acid;N,N-dimethylmethanamine?
The canonical SMILES for boric acid;N,N-dimethylmethanamine is CN(C)C.OB(O)O.
What is the InChIKey of boric acid;N,N-dimethylmethanamine?
The InChIKey is LYSQGYSICZCRKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.BH3O3/c1-4(2)3;2-1(3)4/h1-3H3;2-4H.
What are the key properties of boric acid;N,N-dimethylmethanamine?
boric acid;N,N-dimethylmethanamine has a molecular weight of 120.94 g/mol, XLogP of -1.87, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;N,N-dimethylmethanamine is sourced from PubChem (CID 87240079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).