C22H23F3N2O6 — CID 87240128
1-O-tert-butyl 2-O-(2,2,2-trifluoroacetyl) (2R,4R)-4-isoquinolin-6-yloxypiperidine-1,2-dicarboxylate (PubChem CID 87240128) has the molecular formula C22H23F3N2O6 and a molecular weight of 468.43 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-(2,2,2-trifluoroacetyl) (2R,4R)-4-isoquinolin-6-yloxypiperidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-(2,2,2-trifluoroacetyl) (2R,4R)-4-isoquinolin-6-yloxypiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 87240128 |
| Molecular Formula | C22H23F3N2O6 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 1-O-tert-butyl 2-O-(2,2,2-trifluoroacetyl) (2R,4R)-4-isoquinolin-6-yloxypiperidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](Oc2ccc3cnccc3c2)C[C@@H]1C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C22H23F3N2O6/c1-21(2,3)33-20(30)27-9-7-16(11-17(27)18(28)32-19(29)22(23,24)25)31-15-5-4-14-12-26-8-6-13(14)10-15/h4-6,8,10,12,16-17H,7,9,11H2,1-3H3/t16-,17-/m1/s1 |
| InChIKey | MGYGQZFFPWGZEU-IAGOWNOFSA-N |
| XLogP | 4.01 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|