About formamide;methylurea
formamide;methylurea (PubChem CID 87240897) has the molecular formula C3H9N3O2
and a molecular weight of 119.12 g/mol. Its IUPAC name is formamide;methylurea.
Molecular Properties
| Compound Name | formamide;methylurea |
| PubChem CID | 87240897 |
| Molecular Formula | C3H9N3O2 |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | formamide;methylurea |
| SMILES | CNC(N)=O.NC=O |
| InChI | InChI=1S/C2H6N2O.CH3NO/c1-4-2(3)5;2-1-3/h1H3,(H3,3,4,5);1H,(H2,2,3) |
| InChIKey | AGWWEFOFZCSZNJ-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formamide;methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamide;methylurea?
The IUPAC name of formamide;methylurea (CID 87240897) is formamide;methylurea.
What is the SMILES notation for formamide;methylurea?
The canonical SMILES for formamide;methylurea is CNC(N)=O.NC=O.
What is the InChIKey of formamide;methylurea?
The InChIKey is AGWWEFOFZCSZNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O.CH3NO/c1-4-2(3)5;2-1-3/h1H3,(H3,3,4,5);1H,(H2,2,3).
What are the key properties of formamide;methylurea?
formamide;methylurea has a molecular weight of 119.12 g/mol, XLogP of -1.61, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formamide;methylurea is sourced from PubChem (CID 87240897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).