About 1-ethoxy-3-methylurea
1-ethoxy-3-methylurea (PubChem CID 87241243) has the molecular formula C4H10N2O2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 1-ethoxy-3-methylurea.
Molecular Properties
| Compound Name | 1-ethoxy-3-methylurea |
| PubChem CID | 87241243 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | 1-ethoxy-3-methylurea |
| SMILES | CCONC(=O)NC |
| InChI | InChI=1S/C4H10N2O2/c1-3-8-6-4(7)5-2/h3H2,1-2H3,(H2,5,6,7) |
| InChIKey | WTUNFOIATZGLMM-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-3-methylurea?
The IUPAC name of 1-ethoxy-3-methylurea (CID 87241243) is 1-ethoxy-3-methylurea.
What is the SMILES notation for 1-ethoxy-3-methylurea?
The canonical SMILES for 1-ethoxy-3-methylurea is CCONC(=O)NC.
What is the InChIKey of 1-ethoxy-3-methylurea?
The InChIKey is WTUNFOIATZGLMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2/c1-3-8-6-4(7)5-2/h3H2,1-2H3,(H2,5,6,7).
What are the key properties of 1-ethoxy-3-methylurea?
1-ethoxy-3-methylurea has a molecular weight of 118.14 g/mol, XLogP of -0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-3-methylurea is sourced from PubChem (CID 87241243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).