C20H36O7 — CID 87241383
2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid (PubChem CID 87241383) has the molecular formula C20H36O7 and a molecular weight of 388.50 g/mol. Its IUPAC name is 2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid.
| Compound Name | 2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87241383 |
| Molecular Formula | C20H36O7 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid |
| SMILES | CCCCCCCCCC(CCCCC)(C(=O)O)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H36O7/c1-3-5-7-8-9-10-12-14-19(17(23)24,13-11-6-4-2)20(27,18(25)26)15-16(21)22/h27H,3-15H2,1-2H3,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | WVNTYIQHQMMMDD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|