2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid

C20H36O7 — CID 87241383

IUPAC2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid
SMILESCCCCCCCCCC(CCCCC)(C(=O)O)C(O)(CC(=O)O)C(=O)O
InChIInChI=1S/C20H36O7/c1-3-5-7-8-9-10-12-14-19(17(23)24,13-11-6-4-2)20(27,18(25)26)15-16(21)22/h27H,3-15H2,1-2H3,(H,21,22)(H,23,24)(H,25,26)
InChIKeyWVNTYIQHQMMMDD-UHFFFAOYSA-N
MW388.50 g/mol
LogP4.07
Rot. Bonds17

About 2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid

2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid (PubChem CID 87241383) has the molecular formula C20H36O7 and a molecular weight of 388.50 g/mol. Its IUPAC name is 2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid.

Molecular Properties

Compound Name2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid
PubChem CID87241383
Molecular FormulaC20H36O7
Molecular Weight388.50 g/mol
Exact Mass388.25
IUPAC Name2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid
SMILESCCCCCCCCCC(CCCCC)(C(=O)O)C(O)(CC(=O)O)C(=O)O
InChIInChI=1S/C20H36O7/c1-3-5-7-8-9-10-12-14-19(17(23)24,13-11-6-4-2)20(27,18(25)26)15-16(21)22/h27H,3-15H2,1-2H3,(H,21,22)(H,23,24)(H,25,26)
InChIKeyWVNTYIQHQMMMDD-UHFFFAOYSA-N
XLogP4.07
TPSA132.13 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds17
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500388.50
LogP ≤ 54.07
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid?
The IUPAC name of 2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid (CID 87241383) is 2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid.
What is the SMILES notation for 2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid?
The canonical SMILES for 2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid is CCCCCCCCCC(CCCCC)(C(=O)O)C(O)(CC(=O)O)C(=O)O.
What is the InChIKey of 2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid?
The InChIKey is WVNTYIQHQMMMDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36O7/c1-3-5-7-8-9-10-12-14-19(17(23)24,13-11-6-4-2)20(27,18(25)26)15-16(21)22/h27H,3-15H2,1-2H3,(H,21,22)(H,23,24)(H,25,26).
What are the key properties of 2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid?
2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid has a molecular weight of 388.50 g/mol, XLogP of 4.07, 17 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-pentyldodecane-1,2,3-tricarboxylic acid is sourced from PubChem (CID 87241383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).