C18H23N3O8S3 — CID 87241469
1-[2-[6-[(3-amino-3-oxopropyl)disulfanyl]-2-pyridinyl]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 87241469) has the molecular formula C18H23N3O8S3 and a molecular weight of 505.60 g/mol. Its IUPAC name is 1-[2-[6-[(3-amino-3-oxopropyl)disulfanyl]-2-pyridinyl]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[2-[6-[(3-amino-3-oxopropyl)disulfanyl]-2-pyridinyl]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 87241469 |
| Molecular Formula | C18H23N3O8S3 |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 1-[2-[6-[(3-amino-3-oxopropyl)disulfanyl]-2-pyridinyl]hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | CCCCC(C(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)c1cccc(SSCCC(N)=O)n1 |
| InChI | InChI=1S/C18H23N3O8S3/c1-2-3-5-11(12-6-4-7-15(20-12)31-30-9-8-14(19)22)18(25)29-21-16(23)10-13(17(21)24)32(26,27)28/h4,6-7,11,13H,2-3,5,8-10H2,1H3,(H2,19,22)(H,26,27,28) |
| InChIKey | UQWXDDCZOYNIRQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 174.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|