C28H42F3NO9S — CID 87241492
2,3-ditert-butyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[3-(trifluoromethyl)phenyl]sulfonyloxypropyl]pentanedioic acid (PubChem CID 87241492) has the molecular formula C28H42F3NO9S and a molecular weight of 625.70 g/mol. Its IUPAC name is 2,3-ditert-butyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[3-(trifluoromethyl)phenyl]sulfonyloxypropyl]pentanedioic acid.
| Compound Name | 2,3-ditert-butyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[3-(trifluoromethyl)phenyl]sulfonyloxypropyl]pentanedioic acid |
|---|---|
| PubChem CID | 87241492 |
| Molecular Formula | C28H42F3NO9S |
| Molecular Weight | 625.70 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | 2,3-ditert-butyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[3-(trifluoromethyl)phenyl]sulfonyloxypropyl]pentanedioic acid |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)(C(C(CCCOS(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C28H42F3NO9S/c1-24(2,3)20(27(22(35)36,25(4,5)6)32-23(37)41-26(7,8)9)19(21(33)34)14-11-15-40-42(38,39)18-13-10-12-17(16-18)28(29,30)31/h10,12-13,16,19-20H,11,14-15H2,1-9H3,(H,32,37)(H,33,34)(H,35,36) |
| InChIKey | KKJLWJSAZLRNSR-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 156.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.70 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|