About 2-(5-bromo-2,4-difluorophenyl)acetaldehyde
2-(5-bromo-2,4-difluorophenyl)acetaldehyde (PubChem CID 87241512) has the molecular formula C8H5BrF2O
and a molecular weight of 235.03 g/mol. Its IUPAC name is 2-(5-bromo-2,4-difluorophenyl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(5-bromo-2,4-difluorophenyl)acetaldehyde |
| PubChem CID | 87241512 |
| Molecular Formula | C8H5BrF2O |
| Molecular Weight | 235.03 g/mol |
| Exact Mass | 233.95 |
| IUPAC Name | 2-(5-bromo-2,4-difluorophenyl)acetaldehyde |
| SMILES | O=CCc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C8H5BrF2O/c9-6-3-5(1-2-12)7(10)4-8(6)11/h2-4H,1H2 |
| InChIKey | NBCDIFVNJOFCRQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.03 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-bromo-2,4-difluorophenyl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromo-2,4-difluorophenyl)acetaldehyde?
The IUPAC name of 2-(5-bromo-2,4-difluorophenyl)acetaldehyde (CID 87241512) is 2-(5-bromo-2,4-difluorophenyl)acetaldehyde.
What is the SMILES notation for 2-(5-bromo-2,4-difluorophenyl)acetaldehyde?
The canonical SMILES for 2-(5-bromo-2,4-difluorophenyl)acetaldehyde is O=CCc1cc(Br)c(F)cc1F.
What is the InChIKey of 2-(5-bromo-2,4-difluorophenyl)acetaldehyde?
The InChIKey is NBCDIFVNJOFCRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrF2O/c9-6-3-5(1-2-12)7(10)4-8(6)11/h2-4H,1H2.
What are the key properties of 2-(5-bromo-2,4-difluorophenyl)acetaldehyde?
2-(5-bromo-2,4-difluorophenyl)acetaldehyde has a molecular weight of 235.03 g/mol, XLogP of 2.47, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-2,4-difluorophenyl)acetaldehyde is sourced from PubChem (CID 87241512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).