C28H42F3NO9S — CID 87241520
2-(butoxycarbonylamino)-2,3-ditert-butyl-4-[3-[3-(trifluoromethyl)phenyl]sulfonyloxypropyl]pentanedioic acid (PubChem CID 87241520) has the molecular formula C28H42F3NO9S and a molecular weight of 625.70 g/mol. Its IUPAC name is 2-(butoxycarbonylamino)-2,3-ditert-butyl-4-[3-[3-(trifluoromethyl)phenyl]sulfonyloxypropyl]pentanedioic acid.
| Compound Name | 2-(butoxycarbonylamino)-2,3-ditert-butyl-4-[3-[3-(trifluoromethyl)phenyl]sulfonyloxypropyl]pentanedioic acid |
|---|---|
| PubChem CID | 87241520 |
| Molecular Formula | C28H42F3NO9S |
| Molecular Weight | 625.70 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | 2-(butoxycarbonylamino)-2,3-ditert-butyl-4-[3-[3-(trifluoromethyl)phenyl]sulfonyloxypropyl]pentanedioic acid |
| SMILES | CCCCOC(=O)NC(C(=O)O)(C(C(CCCOS(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C28H42F3NO9S/c1-8-9-15-40-24(37)32-27(23(35)36,26(5,6)7)21(25(2,3)4)20(22(33)34)14-11-16-41-42(38,39)19-13-10-12-18(17-19)28(29,30)31/h10,12-13,17,20-21H,8-9,11,14-16H2,1-7H3,(H,32,37)(H,33,34)(H,35,36) |
| InChIKey | CZYAUYRWQUOMJW-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 156.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.70 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|