C8H4F6O3 — CID 87241656
1,1,1-trifluoro-3-(4,4,4-trifluoro-3-oxobut-1-en-2-yl)oxybut-3-en-2-one (PubChem CID 87241656) has the molecular formula C8H4F6O3 and a molecular weight of 262.11 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(4,4,4-trifluoro-3-oxobut-1-en-2-yl)oxybut-3-en-2-one.
| Compound Name | 1,1,1-trifluoro-3-(4,4,4-trifluoro-3-oxobut-1-en-2-yl)oxybut-3-en-2-one |
|---|---|
| PubChem CID | 87241656 |
| Molecular Formula | C8H4F6O3 |
| Molecular Weight | 262.11 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 1,1,1-trifluoro-3-(4,4,4-trifluoro-3-oxobut-1-en-2-yl)oxybut-3-en-2-one |
| SMILES | C=C(OC(=C)C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C8H4F6O3/c1-3(5(15)7(9,10)11)17-4(2)6(16)8(12,13)14/h1-2H2 |
| InChIKey | UTMKDGVPKBHHPW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.11 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|