C15H16IN3OS — CID 8724208
2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-iodophenyl)ethanone (PubChem CID 8724208) has the molecular formula C15H16IN3OS and a molecular weight of 413.28 g/mol. Its IUPAC name is 2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-iodophenyl)ethanone.
| Compound Name | 2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-iodophenyl)ethanone |
|---|---|
| PubChem CID | 8724208 |
| Molecular Formula | C15H16IN3OS |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | 2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-iodophenyl)ethanone |
| SMILES | CCn1c(SCC(=O)c2ccc(I)cc2)nnc1C1CC1 |
| InChI | InChI=1S/C15H16IN3OS/c1-2-19-14(11-3-4-11)17-18-15(19)21-9-13(20)10-5-7-12(16)8-6-10/h5-8,11H,2-4,9H2,1H3 |
| InChIKey | GSOGSKHCQDJFAM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|