About 2-N,2-N'-bis(benzylideneamino)oxane-2,2-diamine
2-N,2-N'-bis(benzylideneamino)oxane-2,2-diamine (PubChem CID 87242135) has the molecular formula C19H22N4O
and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-N,2-N'-bis(benzylideneamino)oxane-2,2-diamine.
Molecular Properties
| Compound Name | 2-N,2-N'-bis(benzylideneamino)oxane-2,2-diamine |
| PubChem CID | 87242135 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-N,2-N'-bis(benzylideneamino)oxane-2,2-diamine |
| SMILES | C(=NNC1(NN=Cc2ccccc2)CCCCO1)c1ccccc1 |
| InChI | InChI=1S/C19H22N4O/c1-3-9-17(10-4-1)15-20-22-19(13-7-8-14-24-19)23-21-16-18-11-5-2-6-12-18/h1-6,9-12,15-16,22-23H,7-8,13-14H2 |
| InChIKey | HABAEEYXYPCDFG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-N,2-N'-bis(benzylideneamino)oxane-2,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N'-bis(benzylideneamino)oxane-2,2-diamine?
The IUPAC name of 2-N,2-N'-bis(benzylideneamino)oxane-2,2-diamine (CID 87242135) is 2-N,2-N'-bis(benzylideneamino)oxane-2,2-diamine.
What is the SMILES notation for 2-N,2-N'-bis(benzylideneamino)oxane-2,2-diamine?
The canonical SMILES for 2-N,2-N'-bis(benzylideneamino)oxane-2,2-diamine is C(=NNC1(NN=Cc2ccccc2)CCCCO1)c1ccccc1.
What is the InChIKey of 2-N,2-N'-bis(benzylideneamino)oxane-2,2-diamine?
The InChIKey is HABAEEYXYPCDFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O/c1-3-9-17(10-4-1)15-20-22-19(13-7-8-14-24-19)23-21-16-18-11-5-2-6-12-18/h1-6,9-12,15-16,22-23H,7-8,13-14H2.
What are the key properties of 2-N,2-N'-bis(benzylideneamino)oxane-2,2-diamine?
2-N,2-N'-bis(benzylideneamino)oxane-2,2-diamine has a molecular weight of 322.41 g/mol, XLogP of 3.09, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N'-bis(benzylideneamino)oxane-2,2-diamine is sourced from PubChem (CID 87242135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).