C23H30Cl2N4O2 — CID 87242137
4-[2-[3,5-dichloro-2-[[(2R)-2-(2-methylpropyl)pyrrolidin-1-yl]methyl]-6-oxo-1-pyridinyl]ethyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 87242137) has the molecular formula C23H30Cl2N4O2 and a molecular weight of 465.43 g/mol. Its IUPAC name is 4-[2-[3,5-dichloro-2-[[(2R)-2-(2-methylpropyl)pyrrolidin-1-yl]methyl]-6-oxo-1-pyridinyl]ethyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[2-[3,5-dichloro-2-[[(2R)-2-(2-methylpropyl)pyrrolidin-1-yl]methyl]-6-oxo-1-pyridinyl]ethyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 87242137 |
| Molecular Formula | C23H30Cl2N4O2 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 4-[2-[3,5-dichloro-2-[[(2R)-2-(2-methylpropyl)pyrrolidin-1-yl]methyl]-6-oxo-1-pyridinyl]ethyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | CC(C)C[C@H]1CCCN1Cc1c(Cl)cc(Cl)c(=O)n1CCc1ccc(C(N)=NO)cc1 |
| InChI | InChI=1S/C23H30Cl2N4O2/c1-15(2)12-18-4-3-10-28(18)14-21-19(24)13-20(25)23(30)29(21)11-9-16-5-7-17(8-6-16)22(26)27-31/h5-8,13,15,18,31H,3-4,9-12,14H2,1-2H3,(H2,26,27)/t18-/m1/s1 |
| InChIKey | FLZQFLHQQMNLPT-GOSISDBHSA-N |
| XLogP | 4.50 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|