About 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride
2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride (PubChem CID 87243351) has the molecular formula C13H18ClN5
and a molecular weight of 279.78 g/mol. Its IUPAC name is 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride.
Molecular Properties
| Compound Name | 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride |
| PubChem CID | 87243351 |
| Molecular Formula | C13H18ClN5 |
| Molecular Weight | 279.78 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride |
| SMILES | CN(C)c1ccccc1/N=N/c1n(C)cc[n+]1C.[Cl-] |
| InChI | InChI=1S/C13H18N5.ClH/c1-16(2)12-8-6-5-7-11(12)14-15-13-17(3)9-10-18(13)4;/h5-10H,1-4H3;1H/q+1;/p-1 |
| InChIKey | OAOKKONCKCWERN-UHFFFAOYSA-M |
| XLogP | -0.67 |
| TPSA | 36.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.78 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride?
The IUPAC name of 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride (CID 87243351) is 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride.
What is the SMILES notation for 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride?
The canonical SMILES for 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride is CN(C)c1ccccc1/N=N/c1n(C)cc[n+]1C.[Cl-].
What is the InChIKey of 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride?
The InChIKey is OAOKKONCKCWERN-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H18N5.ClH/c1-16(2)12-8-6-5-7-11(12)14-15-13-17(3)9-10-18(13)4;/h5-10H,1-4H3;1H/q+1;/p-1.
What are the key properties of 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride?
2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride has a molecular weight of 279.78 g/mol, XLogP of -0.67, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline chloride is sourced from PubChem (CID 87243351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).